ChemNet > CAS > 69625-13-4 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile
69625-13-4 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile
| product Name |
2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile |
| CAS No |
69625-13-4 |
| Synonyms |
[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile |
| Molecular Formula |
C11H7N3O2S |
| Molecular Weight |
245.2572 |
| InChI |
InChI=1/C11H7N3O2S/c12-6-5-11-13-10(7-17-11)8-1-3-9(4-2-8)14(15)16/h1-4,7H,5H2 |
| Molecular Structure |
![69625-13-4 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile](https://images-a.chemnet.com/suppliers/chembase/124/12490.gif)
|
| Density |
1.397g/cm3 |
| Melting point |
147℃ |
| Boiling point |
457.3°C at 760 mmHg |
| Refractive index |
1.641 |
| Flash point |
230.3°C |
| Vapour Pressur |
1.51E-08mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
